Aniline and substituted anilines
Aobchem 2-Bromo-4-methyl-5-nitroaniline | ≥97% | CAS 102169-99-3 | C7H7BrN2O2 | 25g
2-Bromo-4-methyl-5-nitroaniline | ≥97% | CAS 102169-99-3 | C7H7BrN2O2 | 25g
Apexbio Technology LLC DuP 697 88149-94-4 50mg
DuP 697 (CAS 88149-94-4) is an ortho-diaryl heterocyclic compound that selectively and irreversibly inhibits cyclooxygenase-2 (COX-2) displaying an IC50 of 10 nM for human COX-2 and 800 nM for COX-1 DuP 697 is demonstrated to suppress prostaglandin synthesis and in vitro exhibits antiproliferative pro-apoptotic and anti-angiogenic effects in HT29 colorectal cancer cells (IC50 42 8 nM) This small molecule is commonly utilized to explore COX-2-mediated inflammatory pathways as well as tumor biology providing a valuable tool for dissecting mechanisms underlying inflammation and cancer
eMolecules 771-14-2 | 2-Bromonaphthalen-1-amine | ChemScene | MFCD11870111 | 222.085 | C10H8BrN | 97.000 | Nc1c(Br)ccc2ccccc12 | 1g | 536806586
2-Bromonaphthalen-1-amine | ChemScene | 771-14-2 | MFCD11870111 | 222.085 | C10H8BrN | 97.000 | Nc1c(Br)ccc2ccccc12 | 1g | 536806586
eMolecules 455-58-3 | Ambeed | 2-Bromo-6-Fluoro-4-nitroaniline | 5g | 600849272 | A872022 | MFCD09800780 | 235.012 | C6H4BrFN2O2
ChemScene | (2-Formyl-3-methoxyphenyl)boronic acid | 250mg | 632310348 | CS-0174138 | 958030-46-1 | MFCD01319042 | 179.970 | C8H9BO4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 106-40-1 | 4-Bromoaniline | AA Blocks LLC | MFCD00007822 | 172.025 | C6H6BrN | 0.000 | Nc1ccc(Br)cc1 | 5g | 414475994
4-Bromoaniline | AA Blocks LLC | 106-40-1 | MFCD00007822 | 172.025 | C6H6BrN | 0.000 | Nc1ccc(Br)cc1 | 5g | 414475994
Medchemexpress LLC 4,7-Dibromo-2,1,3-benzothiadiazole | 15155-41-6 | MFCD00658844 | 293.97 | 10 G
4,7-Dibromo-2,1,3-benzothiadiazole is a biochemical reagent used in life science research. It is provided as a solid with high purity and has specific storage requirements to maintain its stability. This compound is toxic if swallowed, requiring careful handling.
- Biochemical reagent for life science research
- Solid appearance, light brown to yellow color
- Molecular weight of 293.97
- Purity greater than 99.52%
- Store powder at -20°C for 3 years or 4°C for 2 years
- Store in solvent at -80°C for 6 months or -20°C for 1 month
eMolecules 1214334-83-4 | 2-Bromo-4-(trifluoromethoxy)benzonitrile | Combi-Blocks, Inc. | MFCD13185874 | 266.017 | C8H3BrF3NO | 97.000 | FC(F)(F)Oc1ccc(C#N)c(Br)c1 | 25g | 703125088
2-Bromo-4-(trifluoromethoxy)benzonitrile | Combi-Blocks, Inc. | 1214334-83-4 | MFCD13185874 | 266.017 | C8H3BrF3NO | 97.000 | FC(F)(F)Oc1ccc(C#N)c(Br)c1 | 25g | 703125088
=O | 1g | 591806711](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502155383.JPG-250.jpg)
eMolecules 2097553-56-3 | 3-(Cyclopropyl)-2-nitroaniline | Apollo Scientific178.191 | C9H10N2O2 | 95.000 | Nc1cccc(C2CC2)c1[N+]([O-])=O | 1g | 591806711
3-(Cyclopropyl)-2-nitroaniline | Apollo Scientific | 2097553-56-3178.191 | C9H10N2O2 | 95.000 | Nc1cccc(C2CC2)c1[N+]([O-])=O | 1g | 591806711
eMolecules 106-40-1 | 4-Bromoaniline | Oakwood Chemical | MFCD00007822 | 172.025 | C6H6BrN | 99.000 | Nc1ccc(Br)cc1 | 1kg | 537663435
4-Bromoaniline | Oakwood Chemical | 106-40-1 | MFCD00007822 | 172.025 | C6H6BrN | 99.000 | Nc1ccc(Br)cc1 | 1kg | 537663435
Medchemexpress LLC 3,4-Dibromo-Mal-PEG2-N-Boc | 1807537-43-4 | 95.3% | C15H22Br2N2O6 | 100 MG
3,4-Dibromo-Mal-PEG2-N-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
- PEG-based PROTAC linker
- Used in the synthesis of PROTACs
- Exploits the intracellular ubiquitin-proteasome system
- Selectively degrades target proteins
- Relevant for cancer and cancer targeted therapy research
![eMolecules 22955-07-3 | 4-(benzyloxy)-3-nitrobenzaldehyde | Synthonix | MFCD02629625 | 257.245 | C14H11NO4 | 97.000 | [O-][N+](=O)c1cc(C=O)ccc1OCc1ccccc1 | 500mg | 784552828](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502462532.JPG-250.jpg)
eMolecules 22955-07-3 | 4-(benzyloxy)-3-nitrobenzaldehyde | Synthonix | MFCD02629625 | 257.245 | C14H11NO4 | 97.000 | [O-][N+](=O)c1cc(C=O)ccc1OCc1ccccc1 | 500mg | 784552828
4-(benzyloxy)-3-nitrobenzaldehyde | Synthonix | 22955-07-3 | MFCD02629625 | 257.245 | C14H11NO4 | 97.000 | [O-][N+](=O)c1cc(C=O)ccc1OCc1ccccc1 | 500mg | 784552828
c1ccc(OC(F)(F)F)cc1 | 100mg | 569144912](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502451793.PNG-250.jpg)
eMolecules 1208989-29-0 | (R)-1-(4-(Trifluoromethoxy)phenyl)ethan-1-amine hydrochloride | ChemScene | MFCD12757221 | 241.640 | C9H11ClF3NO | 97.000 | Cl.C[C@@H](N)c1ccc(OC(F)(F)F)cc1 | 100mg | 569144912
(R)-1-(4-(Trifluoromethoxy)phenyl)ethan-1-amine hydrochloride | ChemScene | 1208989-29-0 | MFCD12757221 | 241.640 | C9H11ClF3NO | 97.000 | Cl.C[C@@H](N)c1ccc(OC(F)(F)F)cc1 | 100mg | 569144912
eMolecules 106-40-1 | 4-Bromoaniline | Key Organics/BIONET | MFCD00007822 | 172.025 | C6H6BrN | 95.000 | Nc1ccc(Br)cc1 | 10mg | 564160127
4-Bromoaniline | Key Organics/BIONET | 106-40-1 | MFCD00007822 | 172.025 | C6H6BrN | 95.000 | Nc1ccc(Br)cc1 | 10mg | 564160127
Aobchem 2 5-Dibromo-4-fluorobenzaldehyde | ≥95% | CAS 1379332-00-9 | C7H3Br2FO | 500mg
2 5-Dibromo-4-fluorobenzaldehyde | ≥95% | CAS 1379332-00-9 | C7H3Br2FO | 500mg